CAS 172733-42-5

Formel: C21H19N2NaO5

InChl: InChI=1S/C21H20N2O5.Na/c1-2-14-19(20(26)21(22)27)18-15(9-6-10-16(18)28-12-17(24)25)23(14)11-13-7-4-3-5-8-13;/h3-10H,2,11-12H2,1H3,(H2,22,27)(H,24,25);/q;+1/p-1

InChI Key: XZZUHXILQXLTGV-UHFFFAOYSA-M

SMILES: CCC1=C(C2=C(N1CC3=CC=CC=C3)C=CC=C2OCC(=O)[O-])C(=O)C(=O)N.[Na+]

Varespladib (sodium)

CAS: 172733-42-5

Varespladib (sodium)

Formel: C₂₁H₁₉N₂NaO₅

Reinheit: ≥95%

Molekulargewicht: 402.38

Ref: 54-OR1130764

Varespladib (sodium)

CAS: 172733-42-5

Reinheit: 98%

Ref: IN-DA00BA51

Varespladib sodium

CAS: 172733-42-5

Varespladib sodium is a potent sPLA2 inhibitor (IC50≈9 nM).

Formel: C₂₁H₁₉N₂NaO₅

Molekulargewicht: 402.38

Ref: TM-T39173

Varespladib sodium

CAS: 172733-42-5

Varespladib sodium is a small molecule that binds to the receptor for thrombin, which is a protein that forms blood clots. It inhibits the activity of the receptor and suppresses the formation of blood clots, thereby reducing the risk of heart attack. Varespladib sodium also inhibits Protein interactions with other proteins and peptides. This drug has been shown to be effective in animal models and is currently undergoing clinical trials.

Formel: C₂₁H₁₉N₂NaO₅

Reinheit: Min. 95%

Molekulargewicht: 402.4 g/mol

Ref: 3D-XGA73342

Varespladib

CAS: 172733-42-5

Formel: C₂₁H₁₉N₂O₅Na

Molekulargewicht: 379.39 : 22.99

Ref: ST-EA-CP-V41000