CAS 189308-09-6

Formel: C22H26O4

InChl: InChI=1S/C22H26O4/c1-12-11-26-19-15-7-8-16-14(6-5-9-21(16,3)4)18(15)22(25,10-13(2)23)20(24)17(12)19/h7-8,12,25H,5-6,9-11H2,1-4H3/t12-,22-/m0/s1

InChI Key: KZLPKGGMSDHTRS-YTEVENLXSA-N

SMILES: C[C@H]1COC2=C1C(=O)[C@@](C3=C2C=CC4=C3CCCC4(C)C)(CC(=O)C)O

Danshenol B

CAS: 189308-09-6

Danshenol B is a natural product that can be used as a reference standard.

Formel: C₂₂H₂₆O₄

Farbe und Form: Solid

Molekulargewicht: 354.44

Ref: TM-T125490

Danshenol B

CAS: 189308-09-6

Danshenol B is a naturally occurring compound from the root of Salvia miltiorrhiza, a type of herbal product used in traditional medicine. It is sourced from the dried root of this plant, commonly known as danshen, which is a member of the mint family. The mode of action of Danshenol B involves the modulation of oxidative stress and inflammation pathways, as it exhibits antioxidant and anti-inflammatory properties. Additionally, it may affect cellular signaling pathways, contributing to its therapeutic potential.

Formel: C₂₂H₂₆O₄

Reinheit: Min. 95%

Molekulargewicht: 354.40 g/mol

Ref: 3D-PHA30809