CAS 2065228-59-1

Formel: C31H43NO7

InChl: InChI=1S/C31H43NO7/c1-5-32-15-29(16-36-2)12-11-21(33)31-19-13-18-20(37-3)14-30(22(19)24(18)34,23(27(31)32)25(38-4)26(29)31)39-28(35)17-9-7-6-8-10-17/h6-10,18-27,33-34H,5,11-16H2,1-4H3/t18-,19-,20+,21+,22-,23?,24+,25+,26-,27?,29+,30-,31?/m1/s1

InChI Key: BKAIYZAGPZZPPF-OHRGUPKJSA-N

SMILES: CCN1C[C@@]2(CC[C@@H](C34[C@@H]2[C@H](C(C31)[C@]5(C[C@@H]([C@H]6C[C@@H]4[C@@H]5[C@H]6O)OC)OC(=O)C7=CC=CC=C7)OC)O)COC

Carmichaenine A

CAS: 2065228-59-1

Carmichaenine A

Molekulargewicht: 541.3

Ref: 10-F566396

Carmichaenine A

CAS: 2065228-59-1

Carmichaenine A is a natiral product from Aconitum carmichaeli.

Formel: C₃₁H₄₃NO₇

Reinheit: 98%

Farbe und Form: Solid

Molekulargewicht: 541.685

Ref: TM-TN3596

Carmichaenine A

CAS: 2065228-59-1

Carmichaenine A is an alkaloid compound, which is derived from the plant family Aconitum. It is known for its potential therapeutic properties, primarily attributed to its complex molecular structure, which allows for specific interactions with cellular components. The mode of action of Carmichaenine A involves the inhibition of specific cellular pathways that are critical for cancer cell proliferation, ultimately inducing apoptosis in malignant cells.

Formel: C₃₁H₄₃NO₇

Reinheit: Min. 95%

Molekulargewicht: 541.7 g/mol

Ref: 3D-QHD22859