CAS 2065228-60-4

Formel: C23H37NO7

InChl: InChI=1S/C23H37NO7/c1-4-24-9-20(10-25)6-5-13(26)23-18(20)16(31-3)14(19(23)24)21(28)8-12(30-2)11-7-22(23,29)17(21)15(11)27/h11-19,25-29H,4-10H2,1-3H3/t11-,12+,13+,14+,15+,16+,17-,18-,19-,20+,21+,22+,23+/m1/s1

InChI Key: IVNCQHJFFGCDLK-YLDGKFAESA-N

SMILES: CCN1C[C@@]2(CC[C@@H]([C@]34[C@@H]2[C@H]([C@@H]([C@H]31)[C@]5(C[C@@H]([C@H]6C[C@@]4([C@@H]5[C@H]6O)O)OC)O)OC)O)CO

Carmichaenine B

CAS: 2065228-60-4

Carmichaenine B

Molekulargewicht: 439.26

Ref: 10-F566450

Carmichaenine B

CAS: 2065228-60-4

Carmichaenine B is a natiral product from Aconitum carmichaeli.

Formel: C₂₃H₃₇NO₇

Reinheit: 98%

Farbe und Form: Solid

Molekulargewicht: 439.549

Ref: TM-TN3597

Carmichaenine B

Kontrolliertes Produkt

CAS: 2065228-60-4

Carmichaenine B is an alkaloid compound, which is derived from the plant species of the Menispermaceae family. This natural product is primarily isolated from traditional medicinal plants and exhibits a variety of biological activities. The mode of action is believed to involve interaction with specific molecular targets within cellular pathways, potentially influencing biochemical activities such as enzyme inhibition or receptor modulation.

Formel: C₂₃H₃₇NO₇

Reinheit: Min. 95%

Molekulargewicht: 439.5 g/mol

Ref: 3D-QHD22860