CAS 2230044-57-0

Formel: C16H16IN3O3S

InChl: InChI=1S/C16H16IN3O3S/c1-3-19(4-2)16-18-11-9(15(22)23)13(21)10(17)12(14(11)24-16)20-7-5-6-8-20/h5-8,21H,3-4H2,1-2H3,(H,22,23)

InChI Key: SEBJATZOIHUGAU-UHFFFAOYSA-N

SMILES: CCN(CC)C1=NC2=C(C(=C(C(=C2S1)N3C=CC=C3)I)O)C(=O)O

MB710

CAS: 2230044-57-0

MB710

Formel: C₁₆H₁₆IN₃O₃S

Reinheit: ≥98%

Molekulargewicht: 457.29

Ref: 54-BUP20823

2-(Diethylamino)-5-hydroxy-6-iodo-7-(1H-pyrrol-1-yl)benzo[d]thiazole-4-carboxylic acid

CAS: 2230044-57-0

Formel: C₁₆H₁₆IN₃O₃S

Reinheit: 95%

Farbe und Form: Solid

Molekulargewicht: 457.2860

Ref: IN-DA023OI4

MB710

CAS: 2230044-57-0

2-(Diethylamino)-5-hydroxy-6-iodo-7-(1H-pyrrol-1-yl)benzo[d]thiazole-4-carboxylic acid

Formel: C₁₆H₁₆IN₃O₃S

Reinheit: 99%

Molekulargewicht: 457.29

Ref: IN-DG01421169

MB710

CAS: 2230044-57-0

MB710 is an analog of indirubin, a traditional Chinese medicine used for the treatment of tumors. It is a potent inhibitor of protein kinases and has shown to induce apoptosis in cancer cells. MB710 has demonstrated anticancer activity by inhibiting the growth of various human cancer cell lines. This compound specifically targets kinases, which play a crucial role in cell signaling pathways that regulate cell growth and division. The inhibition of these kinases by MB710 leads to the suppression of tumor growth and proliferation. MB710 has potential as an effective anticancer agent due to its ability to selectively target cancer cells while sparing normal cells.

Formel: C₁₆H₁₆IN₃O₃S

Reinheit: Min. 95%

Molekulargewicht: 457.3 g/mol

Ref: 3D-FPD04457

MB710

CAS: 2230044-57-0

MB710 is an amino-benzothiazole derivative that tightly binds to the Y220C pocket and stabilizes p53-Y220C in vitro.

Formel: C₁₆H₁₆IN₃O₃S

Reinheit: 99.02%

Farbe und Form: Solid

Molekulargewicht: 457.286

Ref: TM-T9661