CAS 241798-67-4

Formel: C11H10N2O2

InChl: InChI=1S/C11H10N2O2/c1-8-7-13(12-10(8)11(14)15)9-5-3-2-4-6-9/h2-7H,1H3,(H,14,15)

InChI Key: LHRKEPMAEXHVOS-UHFFFAOYSA-N

SMILES: CC1=CN(N=C1C(=O)O)C2=CC=CC=C2

4-Methyl-1-phenyl-1H-pyrazole-3-carboxylic acid

CAS: 241798-67-4

4-Methyl-1-phenyl-1H-pyrazole-3-carboxylic acid

Formel: C₁₁H₁₀N₂O₂

Reinheit: 95%

Molekulargewicht: 202.21

Ref: 54-OR1073487

4-Methyl-1-phenyl-1H-pyrazole-3-carboxylic acid

CAS: 241798-67-4

Formel: C₁₁H₁₀N₂O₂

Reinheit: 95%

Farbe und Form: Solid

Molekulargewicht: 202.2093

Ref: IN-DA01ACYF

4-Methyl-1-phenyl-1H-pyrazole-3-carboxylic acid

CAS: 241798-67-4

4-Methyl-1-phenyl-1H-pyrazole-3-carboxylic acid

Formel: C₁₁H₁₀N₂O₂

Reinheit: 95%

Molekulargewicht: 202.21

Ref: IN-DG00841738

4-Methyl-1-phenyl-1H-pyrazole-3-carboxylic acid

CAS: 241798-67-4

Reinheit: 95%

Molekulargewicht: 202.2129974

Ref: 10-F695366

4-Methyl-1-phenyl-1H-pyrazole-3-carboxylic acid

CAS: 241798-67-4

4-Methyl-1-phenyl-1H-pyrazole-3-carboxylic acid is a polyfunctional pyrazole with the general structure of a carboxylic acid. It is hydrolyzed in an alkaline environment to form a peroxide and hydrogen peroxide. This compound can be used as a reagent for the preparation of esters. 4-Methyl-1-phenyl-1H-pyrazole-3-carboxylic acid has been shown to be an effective catalyst for the synthesis of polyfunctional esters, such as ethylene carbonate.

Formel: C₁₁H₁₀N₂O₂

Reinheit: Min. 95%

Molekulargewicht: 202.21 g/mol

Ref: 3D-RJA79867