CAS 27773-86-0

Formel: C13H19NO4

InChl: InChI=1S/C13H19NO4/c1-3-9(2)13(16)18-8-10-4-6-14(17)7-5-11(15)12(10)14/h3-4,11-12,15H,5-8H2,1-2H3/b9-3-/t11-,12-,14?/m1/s1

InChI Key: HHIPTBVXCKBSAM-ZSXZLUMUSA-N

SMILES: C/C=C(/C)\C(=O)OCC1=CC[N+]2([C@H]1[C@@H](CC2)O)[O-]

9-Angeloylretronecine N-oxide

CAS: 27773-86-0

9-Angeloylretronecine N-oxide is a natural product for research related to life sciences. The catalog number is TN3312 and the CAS number is 27773-86-0.

Formel: C₁₃H₁₉NO₄

Reinheit: 98%

Farbe und Form: Solid

Molekulargewicht: 253.29

Ref: TM-TN3312

9-Angeloylretronecine N-oxide

CAS: 27773-86-0

Formel: C₁₃H₁₉NO₄

Reinheit: 95%~99%

Molekulargewicht: 253.298

Ref: BP-BP6097

9-Angeloylretronecine N-oxide

CAS: 27773-86-0

9-Angeloylretronecine N-oxide is an alkaloid, which is a naturally occurring compound typically found in certain plant species. It is derived from plants belonging to the Boraginaceae family, known for containing various pyrrolizidine alkaloids. These compounds frequently occur as plant defense mechanisms against herbivores.

Formel: C₁₃H₁₉NO₄

Reinheit: Min. 95%

Molekulargewicht: 253.29 g/mol

Ref: 3D-CBA77386