CAS 42060-21-9

Formel: C8H18ClNO2

InChl: InChI=1S/C8H17NO2.ClH/c1-3-9(4-2)7-5-6-8(10)11;/h3-7H2,1-2H3,(H,10,11);1H

InChI Key: ZRHAADCYUIHWGZ-UHFFFAOYSA-N

SMILES: CCN(CC)CCCC(=O)O.Cl

4-(Diethylamino)butanoic acid hydrochloride

CAS: 42060-21-9

4-(Diethylamino)butanoic acid hydrochloride

Formel: C₈H₁₈ClNO₂

Reinheit: 97%

Molekulargewicht: 195.69

Ref: 54-OR1069861

4-(Diethylamino)butanoic acid hydrochloride

CAS: 42060-21-9

Reinheit: 95%

Ref: IN-DA0073O7

4-(Diethylamino)butanoic acid hydrochloride

CAS: 42060-21-9

Reinheit: 98%

Molekulargewicht: 195.1

Ref: 10-F574828

4-(Diethylamino)butanoic Acid Hydrochloride

Kontrolliertes Produkt

CAS: 42060-21-9

Formel: C₈H₁₇NO₂•HCl

Farbe und Form: Neat

Molekulargewicht: 159.23 + (36.46)

Ref: TR-D531710

4-(Diethylamino)butyric acid hydrochloride

CAS: 42060-21-9

4-(Diethylamino)butyric acid hydrochloride is a potent antimalarial drug that belongs to the group of benzothiopyrans. It has been shown to be an effective treatment for malaria. This compound is a phenolic compound, which contains a phenol group in its chemical structure. The esterification of 4-(diethylamino)butyric acid hydrochloride with water-soluble derivatives such as acetyl chloride or acetic anhydride yields water-soluble derivatives.

Formel: C₈H₁₈ClNO₂

Reinheit: Min. 95%

Molekulargewicht: 195.69 g/mol

Ref: 3D-SBA06021