CAS 5942-25-6

Formel: C10H13NO4

InChl: InChI=1S/C10H13NO4/c1-15-9-6-7(2-3-8(9)13)10(14)11-4-5-12/h2-3,6,12-13H,4-5H2,1H3,(H,11,14)

InChI Key: JDMYVMZSGKUWLR-UHFFFAOYSA-N

SMILES: COC1=C(C=CC(=C1)C(=O)NCCO)O

Bryonamide B

CAS: 5942-25-6

Bryonamide B

Formel: C₁₀H₁₃NO₄

Reinheit: ≥98%

Molekulargewicht: 211.21

Ref: 54-BUP07323

Bryonamide B

CAS: 5942-25-6

Formel: C₁₀H₁₃NO₄

Molekulargewicht: 211.22

Ref: 7W-GY3900

Bryonamide B

CAS: 5942-25-6

Bryonamide B is a cucurbitane triterpene that can be extracted from Bryonia aspera.

Formel: C₁₀H₁₃NO₄

Reinheit: 99.97%

Farbe und Form: White Solid

Molekulargewicht: 211.2145

Ref: TM-TN1457

Bryonamide B

CAS: 5942-25-6

Formel: C₁₀H₁₃NO₄

Reinheit: 95%~99%

Molekulargewicht: 211.217

Ref: BP-BP4418

Bryonamide B

CAS: 5942-25-6

Ref: IN-DA01V38F

Bryonamide B

CAS: 5942-25-6

Bryonamide B is a cyclic peptide that acts as a cytotoxic compound, which is derived from marine cyanobacteria, specifically within the order Nostocales. This compound is produced through the secondary metabolic processes of these microorganisms, highlighting its natural origin and the complex biosynthesis pathways involved. Marine cyanobacteria are renowned for their ability to produce a plethora of bioactive substances with diverse biological activities.

Formel: C₁₀H₁₃NO₄

Reinheit: Min. 95%

Molekulargewicht: 211.21 g/mol

Ref: 3D-FAA94225