CAS 736990-88-8

Formel: C8H4F2O3

InChl: InChI=1S/C8H4F2O3/c9-6-1-4(8(12)13)2-7(10)5(6)3-11/h1-3H,(H,12,13)

InChI Key: FRAXEZGWRAVEIK-UHFFFAOYSA-N

SMILES: C1=C(C=C(C(=C1F)C=O)F)C(=O)O

3,5-Difluoro-4-formylbenzoic acid

CAS: 736990-88-8

Formel: C₈H₄F₂O₃

Reinheit: 97%

Farbe und Form: Solid

Molekulargewicht: 186.1124

Ref: IN-DA00394D

3,5-Difluoro-4-formylbenzoic acid

CAS: 736990-88-8

3,5-Difluoro-4-formylbenzoic acid

Formel: C₈H₄F₂O₃

Reinheit: >97%

Molekulargewicht: 186.11236

Ref: 54-PC201295

3,5-Difluoro-4-formylbenzoic acid

CAS: 736990-88-8

Formel: C₈H₄F₂O₃

Reinheit: 95%

Farbe und Form: Liquid

Molekulargewicht: 186.114

Ref: 10-F329977

3,5-Difluoro-4-formylbenzoic acid

CAS: 736990-88-8

3,5-Difluoro-4-formylbenzoic acid

Formel: C₈H₄F₂O₃

Reinheit: 97%

Molekulargewicht: 186.11

Ref: IN-DG242150

3,5-difluoro-4-formylbenzoic Acid

CAS: 736990-88-8

3,5-Difluoro-4-formylbenzoic acid is a sulfamic acid derivative that is used as a catalyst in the synthesis of aldehydes. The catalytic activity of 3,5-difluoro-4-formylbenzoic acid is due to its ability to be oxidized by air and light to give an active form. It also has other uses in the synthesis of dihydropyrans and regioselectivity studies.

Formel: C₈H₄F₂O₃

Reinheit: Min. 95%

Molekulargewicht: 186.11 g/mol

Ref: 3D-FD105094