CAS 79297-08-8

Formel: C12H20O10

InChl: InChI=1S/C12H20O10/c13-1-3-5(14)10(7(16)11(18)20-3)22-12-8(17)9-6(15)4(21-12)2-19-9/h3-18H,1-2H2/t3-,4-,5+,6+,7-,8-,9+,10+,11-,12-/m1/s1

InChI Key: JWMBOBQNPBCYER-TWZFJHAESA-N

SMILES: C1[C@@H]2[C@@H]([C@H](O1)[C@H]([C@H](O2)O[C@H]3[C@H]([C@H](O[C@H]([C@@H]3O)O)CO)O)O)O

Neocarrabiose (b anomer, crystalline)

CAS: 79297-08-8

Neocarrabiose is a complex carbohydrate that is synthesized by the methylation of carrageenan. It has a molecular weight of about 1,000 Daltons and consists of a linear chain of alternating units of D-galactose and D-glucuronic acid. Neocarrabiose is used in the production of polysaccharides such as heparin, glycosaminoglycans, and polysulfated glycosaminoglycans. The enzyme modification process converts the anomeric configuration to L-arabinofuranose in order to produce polysaccharides with high purity.

Formel: C₁₂H₂₀O₁₀

Reinheit: Min. 95%

Molekulargewicht: 324.28 g/mol

Ref: 3D-MN01652