CAS 828923-27-9

Formel: C32H24O10

InChl: InChI=1S/C32H24O10/c1-39-18-6-3-15(4-7-18)26-14-24(38)31-22(36)12-21(35)29(32(31)42-26)19-9-16(5-8-25(19)40-2)27-13-23(37)30-20(34)10-17(33)11-28(30)41-27/h3-12,14,27,33-36H,13H2,1-2H3/t27-/m0/s1

InChI Key: DAZOCAXXKGNMBF-MHZLTWQESA-N

SMILES: COC1=CC=C(C=C1)C2=CC(=O)C3=C(O2)C(=C(C=C3O)O)C4=C(C=CC(=C4)[C@@H]5CC(=O)C6=C(C=C(C=C6O5)O)O)OC

2,3-Dihydroisoginkgetin

CAS: 828923-27-9

2,3-Dihydroisoginkgetin is a Tyrosinase inhibitor with 36.84% inhibition at 0.1 mM.

Formel: C₃₂H₂₄O₁₀

Reinheit: 98%

Farbe und Form: Solid

Molekulargewicht: 568.53

Ref: TM-TN2698

2,3-Dihydroisoginkgetin

CAS: 828923-27-9

Formel: C₃₂H₂₄O₁₀

Reinheit: 95%~99%

Farbe und Form: Yellow powder

Molekulargewicht: 568.534

Ref: BP-SBP02908

2,3-Dihydroisoginkgetin

CAS: 828923-27-9

2,3-Dihydroisoginkgetin is a biflavonoid compound, which is a type of flavone primarily derived from the leaves of the Ginkgo biloba tree. This bioactive compound exhibits a unique structure that contributes to its pharmacological properties. It functions through multiple mechanisms, prominently by influencing various cellular signaling pathways. Notably, it exerts anti-inflammatory effects by inhibiting the activation of nuclear factor-kappa B (NF-κB), a key transcription factor involved in inflammatory responses. Additionally, its anticancer potential is harnessed through its ability to induce apoptosis and inhibit cell proliferation in cancerous cells.

Formel: C₃₂H₂₄O₁₀

Reinheit: Min. 95%

Molekulargewicht: 568.5 g/mol

Ref: 3D-DIB92327