CAS 830347-16-5

Formel: C20H28O4

InChl: InChI=1S/C20H28O4/c1-11-16-14(24-18(11)23)9-13-12(17(16)22)5-6-15-19(2,10-21)7-4-8-20(13,15)3/h14-15,17,21-22H,4-10H2,1-3H3/t14-,15-,17+,19+,20+/m1/s1

InChI Key: YTFCPUQQLYHDRF-VCNAKFCDSA-N

SMILES: CC1=C2[C@@H](CC3=C([C@@H]2O)CC[C@H]4[C@]3(CCC[C@@]4(C)CO)C)OC1=O

Phlogacantholide B

CAS: 830347-16-5

Phlogacantholide B

Molekulargewicht: 332.2

Ref: 10-F566438

Phlogacantholide B

CAS: 830347-16-5

Phlogacantholide B is a natural product from Phlogacanthus curviflorus.

Formel: C₂₀H₂₈O₄

Reinheit: 98%

Farbe und Form: Solid

Molekulargewicht: 332.43

Ref: TM-TN4764

Phlogacantholide B

Kontrolliertes Produkt

CAS: 830347-16-5

Phlogacantholide B is a diterpenoid lactone compound, which is a bioactive metabolite isolated from plants of the Acanthaceae family. This secondary metabolite is sourced primarily from species like Phlogacanthus thyrsiformis, where it is extracted through meticulous phytochemical processes. The mode of action of Phlogacantholide B involves interacting with various biochemical pathways, notably affecting enzyme activities and cellular signaling processes critical in inflammation and cancer pathways.

Formel: C₂₀H₂₈O₄

Reinheit: Min. 95%

Molekulargewicht: 332.4 g/mol

Ref: 3D-FIB34716

Phlogacantholide B

CAS: 830347-16-5

Formel: C₂₀H₂₈O₄

Reinheit: 98.5%

Molekulargewicht: 332.4339

Ref: IN-DA01V4PB