CAS 830347-18-7

Formel: C26H38O9

InChl: InChI=1S/C26H38O9/c1-12-18-15(34-23(12)32)9-14-13(19(18)28)5-6-17-25(2,7-4-8-26(14,17)3)11-33-24-22(31)21(30)20(29)16(10-27)35-24/h15-17,19-22,24,27-31H,4-11H2,1-3H3/t15-,16-,17-,19+,20-,21+,22-,24-,25+,26+/m1/s1

InChI Key: USHSVQJEZJGRFF-CPHRPWCNSA-N

SMILES: CC1=C2[C@@H](CC3=C([C@@H]2O)CC[C@H]4[C@]3(CCC[C@@]4(C)CO[C@H]5[C@@H]([C@H]([C@@H]([C@H](O5)CO)O)O)O)C)OC1=O

Phlogacanthoside A

CAS: 830347-18-7

Phlogacanthoside A

Molekulargewicht: 494.25

Ref: 10-F566380

Phlogacanthoside A

CAS: 830347-18-7

Phlogacanthoside A is a natural product from Phlogacanthus curviflorus.

Formel: C₂₆H₃₈O₉

Reinheit: 98%

Farbe und Form: Solid

Molekulargewicht: 494.57

Ref: TM-TN4765

Phlogacanthoside A

CAS: 830347-18-7

Phlogacanthoside A is a bioactive compound, which is a natural glycoside extracted from the plant Phlogacanthus thyrsiformis, a member of the Acanthaceae family. This compound is part of a class of secondary metabolites known for their biological activity, particularly in medicinal chemistry. Phlogacanthoside A functions through its interaction with certain cellular pathways that can modulate inflammation, possibly by inhibiting specific enzymes or signaling molecules involved in the inflammatory response.

Formel: C₂₆H₃₈O₉

Reinheit: Min. 95%

Molekulargewicht: 494.6 g/mol

Ref: 3D-FIB34718