CAS 83156-04-1

Formel: C20H24O7

InChl: InChI=1S/C20H24O7/c1-6-11(2)19(23)27-18(20(3,4)24)17(22)13-9-12-7-8-16(21)26-14(12)10-15(13)25-5/h6-10,17-18,22,24H,1-5H3/b11-6+/t17-,18+/m1/s1

InChI Key: GFMYIOGFYYHKLA-ZRKIHGRPSA-N

SMILES: C/C=C(\C)/C(=O)O[C@@H]([C@@H](C1=C(C=C2C(=C1)C=CC(=O)O2)OC)O)C(C)(C)O

Angelol B

CAS: 83156-04-1

Angelol B

Molekulargewicht: 376.15

Ref: 10-F565186

AngelolB

CAS: 83156-04-1

AngelolB

Formel: C₂₀H₂₄O₇

Reinheit: ≥98%

Molekulargewicht: 376.4

Ref: 54-OR1127102

Angelol B

CAS: 83156-04-1

Formel: C₂₀H₂₄O₇

Molekulargewicht: 376.41

Ref: 7W-GY5196

Angelol B

CAS: 83156-04-1

Formel: C₂₀H₂₄O₇

Reinheit: 95%~99%

Molekulargewicht: 376.405

Ref: BP-BP3751

AngelolB

CAS: 83156-04-1

Formel: C₂₀H₂₄O₇

Reinheit: 98%

Molekulargewicht: 376.4004

Ref: IN-DA01DDDP

Angelol B

CAS: 83156-04-1

The absorption and transport of angelol A and Angelol B are passive diffusion as the dominating process in Caco-2 cell monolayer model.

Formel: C₂₀H₂₄O₇

Reinheit: 98%

Farbe und Form: Solid

Molekulargewicht: 376.4004

Ref: TM-TN1387

Angelol B

CAS: 83156-04-1

Angelol B is a phytochemical compound, which is a bioactive product derived from natural sources such as plants in the Angelica genus. It operates through a mode of action that involves the disruption of microbial cell walls, leading to cell lysis and subsequent inhibition of microbial growth. Angelol B's multifaceted mechanism makes it an effective antimicrobial agent against a broad spectrum of pathogens.

Formel: C₂₀H₂₄O₇

Reinheit: Min. 95%

Molekulargewicht: 376.4 g/mol

Ref: 3D-IDA15604