CAS 83459-37-4

Formel: C10H12O4

InChl: InChI=1S/C10H12O4/c1-5-7(12)4-8(14-3)9(6(2)11)10(5)13/h4,12-13H,1-3H3

InChI Key: RFKMWWMZUHXFBA-UHFFFAOYSA-N

SMILES: CC1=C(C(=C(C=C1O)OC)C(=O)C)O

Ebracteolata cpd B

CAS: 83459-37-4

Ebracteolata cpd B

Molekulargewicht: 196.07

Ref: 10-F565736

Ebracteolata cpd B

CAS: 83459-37-4

Ebracteolata cpd B

Formel: C₁₀H₁₂O₄

Reinheit: ≥98%

Molekulargewicht: 196.2

Ref: 54-OR1117106

Ebracteolata cpd B

CAS: 83459-37-4

Ebracteolata cpd B is a natural product for research related to life sciences. The catalog number is TN3909 and the CAS number is 83459-37-4.

Formel: C₁₀H₁₂O₄

Reinheit: 98%

Farbe und Form: Solid

Molekulargewicht: 196.1999

Ref: TM-TN3909

Ebracteolata Cpd B

CAS: 83459-37-4

Formel: C₁₀H₁₂O₄

Reinheit: 95%~99%

Farbe und Form: Powder

Molekulargewicht: 196.202

Ref: BP-SBP04117

Ebracteolata cpd B

CAS: 83459-37-4

Formel: C₁₀H₁₂O₄

Reinheit: 98%

Molekulargewicht: 196.1999

Ref: IN-DA00G8CW

1-(2,4-Dihydroxy-6-methoxy-3-methylphenyl)ethanone

CAS: 83459-37-4

1-(2,4-Dihydroxy-6-methoxy-3-methylphenyl)ethanone is a phenolic compound, which is a naturally occurring secondary metabolite often found in plant species. It is primarily derived from various botanical sources, where it plays a role in the plant's defense mechanisms and contributes to its antioxidant properties.

Formel: C₁₀H₁₂O₄

Reinheit: Min. 95%

Molekulargewicht: 196.2 g/mol

Ref: 3D-IDA45937