CAS 84640-31-3

Formel: C10H12N2O4

InChl: InChI=1S/C10H12N2O4/c1-11(2)10(13)16-7-8-3-5-9(6-4-8)12(14)15/h3-6H,7H2,1-2H3

InChI Key: QJZHQJPHPSYDCR-UHFFFAOYSA-N

SMILES: CN(C)C(=O)OCC1=CC=C(C=C1)[N+](=O)[O-]

Carbamic acid

CAS: 84640-31-3

Carbamic acid is an unstable intermediate species, which is primarily derived from the reaction of ammonia with carbon dioxide. This compound is not typically isolated due to its rapid decomposition, but it plays a crucial role in various chemical and biochemical processes. As a reactive intermediate, its mode of action involves the formation of carbamate groups when reacting with alcohols or amines, which can then undergo further transformations or act as protective groups in chemical syntheses.

Formel: C₁₀H₁₂N₂O₄

Reinheit: Min. 95%

Molekulargewicht: 224.21 g/mol

Ref: 3D-JDA64031