CAS 847835-17-0

Formel: C36H44O15

InChl: InChI=1S/C36H44O15/c1-17-24(42)13-25(48-18(2)38)35(16-46-32(44)22-11-9-8-10-12-22)26(17)28(49-19(3)39)27-23(14-37)29(43)34(7)36(45,33(27,6)15-47-34)31(51-21(5)41)30(35)50-20(4)40/h8-12,23-28,30-31,37,42,45H,1,13-16H2,2-7H3/t23-,24+,25+,26+,27+,28+,30+,31+,33+,34-,35-,36+/m1/s1

InChI Key: ZFXSJZPTCKIFHG-CXFIUYFASA-N

SMILES: CC(=O)O[C@H]1C[C@@H](C(=C)[C@@H]2[C@@]1([C@H]([C@@H]([C@@]3([C@]4(CO[C@@]3(C(=O)[C@@H]([C@H]4[C@H]2OC(=O)C)CO)C)C)O)OC(=O)C)OC(=O)C)COC(=O)C5=CC=CC=C5)O

Tasumatrol L

CAS: 847835-17-0

Tasumatrol L

Molekulargewicht: 716.27

Ref: 10-F566462

Tasumatrol L

CAS: 847835-17-0

Tasumatrol L is a natural product from Taxus sumatrana.

Formel: C₃₆H₄₄O₁₅

Reinheit: 98%

Farbe und Form: Solid

Molekulargewicht: 716.73

Ref: TM-TN5101

Tasumatrol L

CAS: 847835-17-0

Formel: C₃₆H₄₄O₁₅

Reinheit: 95%~99%

Molekulargewicht: 716.733

Ref: BP-SBP04444

Tasumatrol L

CAS: 847835-17-0

Tasumatrol L is a chemical compound used as a neuroinhibitory agent, which is sourced synthetically through advanced organic synthesis techniques. It operates by selectively binding to specific neurotransmitter receptors in neuronal cells, thereby modulating synaptic transmission and inhibiting neural activity. This compound's mechanism of action allows it to be a valuable tool in neurophysiological research, where precise modulation of neural pathways is required.

Formel: C₃₆H₄₄O₁₅

Reinheit: Min. 95%

Molekulargewicht: 716.7 g/mol

Ref: 3D-XIB83517