CAS 848463-13-8

Formel: C18H16N2O4

InChl: InChI=1S/C18H16N2O4/c1-10-15(20-8-4-3-5-14(20)17(10)24-2)16(21)11-6-7-13(19)12(9-11)18(22)23/h3-9H,19H2,1-2H3,(H,22,23)

InChI Key: SNMCWIDCSPHZRD-UHFFFAOYSA-N

SMILES: CC1=C(N2C=CC=CC2=C1OC)C(=O)C3=CC(=C(C=C3)N)C(=O)O

2-Amino-5-[(1-methoxy-2-methylindolizin-3-yl)carbonyl]benzoic acid

CAS: 848463-13-8

2-Amino-5-[(1-methoxy-2-methylindolizin-3-yl)carbonyl]benzoic acid is a sophisticated organic compound, typically synthesized for scientific research purposes. It is derived through multi-step chemical processes that integrate functional groups to achieve its specific structure. This compound functions by interacting with biological targets at the molecular level, potentially influencing biochemical pathways and signaling mechanisms.

Formel: C₁₈H₁₆N₂O₄

Reinheit: Min. 95%

Molekulargewicht: 324.3 g/mol

Ref: 3D-YIB46313

SSR128129E free acid

CAS: 848463-13-8

SSR128129E free acid is an orally available and allosteric inhibitor of FGFR(IC50 of 1.9 μM for FGFR1).

Formel: C₁₈H₁₆N₂O₄

Reinheit: 98%

Farbe und Form: Solid

Molekulargewicht: 324.33

Ref: TM-T13003