CAS 86362-16-5

Formel: C15H24O10

InChl: InChI=1S/C15H24O10/c1-14(21)4-7(17)15(22)2-3-23-13(11(14)15)25-12-10(20)9(19)8(18)6(5-16)24-12/h2-3,6-13,16-22H,4-5H2,1H3/t6-,7+,8-,9+,10-,11-,12+,13+,14+,15-/m1/s1

InChI Key: XUWSHXDEJOOIND-VOAFIZDZSA-N

SMILES: C[C@@]1(C[C@@H]([C@]2([C@@H]1[C@@H](OC=C2)O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O)O)O)O

6-Epiharpagide

CAS: 86362-16-5

6-Epiharpagide is a natural product from Scrophularia ningpoensis Hemsl.

Formel: C₁₅H₂₄O₁₀

Reinheit: 98%

Farbe und Form: Solid

Molekulargewicht: 364.3451

Ref: TM-TN3166

6-Epiharpagide

CAS: 86362-16-5

Formel: C₁₅H₂₄O₁₀

Reinheit: 95%~99%

Farbe und Form: Powder

Molekulargewicht: 364.347

Ref: BP-SBP02436

Ajugol

CAS: 86362-16-5

Ajugol is a natural compound, specifically an iridoid glycoside, which is derived from plants, predominantly those in the Lamiaceae family, such as Ajuga species. Iridoid glycosides are a class of secondary metabolites known for their diverse biological activities. Ajugol acts primarily through modulating biochemical pathways involved in inflammation and oxidative stress. This modulation is achieved by interacting with specific enzymes and receptors that play roles in these processes, potentially providing therapeutic benefits.

Formel: C₁₅H₂₄O₁₀

Reinheit: Min. 95%

Molekulargewicht: 364.34 g/mol

Ref: 3D-LDA36216