CAS 87627-17-6

Formel: C17H12O4

InChl: InChI=1S/C17H12O4/c18-15(19)9-12-7-4-8-13-16(20)14(10-21-17(12)13)11-5-2-1-3-6-11/h1-8,10H,9H2,(H,18,19)

InChI Key: FMQFDPXKSNAJLI-UHFFFAOYSA-N

SMILES: C1=CC=C(C=C1)C2=COC3=C(C=CC=C3C2=O)CC(=O)O

2-(4-Oxo-3-phenyl-4H-chromen-8-yl)acetic acid

CAS: 87627-17-6

2-(4-Oxo-3-phenyl-4H-chromen-8-yl)acetic acid

Reinheit: 95+%

Molekulargewicht: 280.2789917

Ref: 10-F899023

2-(4-Oxo-3-phenyl-4H-chromen-8-yl)acetic acid

CAS: 87627-17-6

2-(4-Oxo-3-phenyl-4H-chromen-8-yl)acetic acid is a synthetic flavonoid derivative, which is a chemically synthesized compound often explored for its potential biological activities. It is derived from the structural framework of chromones, a class of naturally occurring compounds found in various plants that exhibit wide-ranging pharmacological properties. The mode of action for this compound involves the inhibition of free radical formation through its potential antioxidant capabilities, due to its ability to stabilize reactive oxygen species and prevent oxidative damage to cells.

Formel: C₁₇H₁₂O₄

Reinheit: Min. 95%

Molekulargewicht: 280.27 g/mol

Ref: 3D-MDA62717

2-(4-Oxo-3-phenyl-4H-chromen-8-yl)acetic acid

CAS: 87627-17-6

Formel: C₁₇H₁₂O₄

Molekulargewicht: 280.2748

Ref: IN-DA004LN4