CAS 877875-96-2

Formel: C21H26O8

InChl: InChI=1S/C21H26O8/c1-26-16-11-14(6-7-15(16)24)20(25)19(12-23)29-21-17(27-2)9-13(5-4-8-22)10-18(21)28-3/h4-7,9-11,19-20,22-25H,8,12H2,1-3H3/b5-4+/t19-,20+/m1/s1

InChI Key: JVQPMSYMHZSFNV-UHDDOPSISA-N

SMILES: COC1=CC(=CC(=C1O[C@H](CO)[C@H](C2=CC(=C(C=C2)O)OC)O)OC)/C=C/CO

erythro-Guaiacylglycerol-β-O-4’-sinapyl ether

CAS: 877875-96-2

erythro-Guaiacylglycerol-β-O-4’-sinapyl ether

Molekulargewicht: 406.16

Ref: 10-F566555

erythro-Guaiacylglycerol β-sinapyl ether

CAS: 877875-96-2

erythro-Guaiacylglycerol beta-sinapyl ether is a natural product of Sambucus, Caprifoliaceae.

Formel: C₂₁H₂₆O₈

Reinheit: 98%

Farbe und Form: Solid

Molekulargewicht: 406.43

Ref: TM-TN4007

erythro-Guaiacylglycerol β-sinapyl ether

CAS: 877875-96-2

Formel: C₂₁H₂₆O₈

Reinheit: 95%~99%

Molekulargewicht: 406.431

Ref: BP-SBP03227

Erythro-guaiacylglycerol β-sinapyl ether

CAS: 877875-96-2

Erythro-guaiacylglycerol β-sinapyl ether is a lignin model compound, which is synthetically derived for research purposes. It originates from plant biomass, specifically as a structural component of lignin, which is a complex aromatic polymer found in the cell walls of plants. This model compound mimics segments of the lignin polymer, making it valuable for analytical studies.

Formel: C₂₁H₂₆O₈

Reinheit: Min. 95%

Molekulargewicht: 406.4 g/mol

Ref: 3D-CKB87596