CAS 879290-98-9

Formel: C18H24O3

InChl: InChI=1S/C18H24O3/c1-5-17(4)10-11-18(12(2)3)20-15(16(17)21-18)13-6-8-14(19)9-7-13/h5-9,12,15-16,19H,1,10-11H2,2-4H3/t15-,16+,17-,18-/m1/s1

InChI Key: BPUKUJAZQKFJAN-XMTFNYHQSA-N

SMILES: CC(C)[C@@]12CC[C@@]([C@@H](O1)[C@H](O2)C3=CC=C(C=C3)O)(C)C=C

Psoracorylifol B

CAS: 879290-98-9

Psoracorylifol B

Molekulargewicht: 288.17

Ref: 10-F561992

Psoracorylifol B

CAS: 879290-98-9

Psoracorylifol B is a natural product that can be used as a reference standard.

Formel: C₁₈H₂₄O₃

Farbe und Form: Solid

Molekulargewicht: 288.38

Ref: TM-T124016

Psoracorylifol B

CAS: 879290-98-9

Psoracorylifol B is a natural compound, specifically a type of coumestan, which is derived from the seeds of the plant *Psoralea corylifolia*. This plant is a traditional source of medicinal compounds, often studied for its bioactive properties. Psoracorylifol B functions primarily through its interaction with cellular pathways, exhibiting potential anti-inflammatory and antioxidant activities. It may affect the modulation of signaling pathways that regulate cellular responses to inflammation and oxidative stress.

Formel: C₁₈H₂₄O₃

Reinheit: Min. 95%

Molekulargewicht: 288.40 g/mol

Ref: 3D-EKB29098