CAS 886990-00-7

Formel: C15H20O3

InChl: InChI=1S/C15H20O3/c1-9-5-4-6-10(2)8-13-14(12(16)7-9)11(3)15(17)18-13/h5,8,12-14,16H,3-4,6-7H2,1-2H3/b9-5-,10-8-/t12-,13-,14+/m0/s1

InChI Key: PDEJECFRCJOMEN-QTTQIYLTSA-N

SMILES: C/C/1=C/[C@H]2[C@@H]([C@H](C/C(=C\CC1)/C)O)C(=C)C(=O)O2

Neobritannilactone B

CAS: 886990-00-7

Neobritannilactone B is a useful organic compound for research related to life sciences and the catalog number is T123996.

Formel: C₁₅H₂₀O₃

Farbe und Form: Solid

Molekulargewicht: 248.32

Ref: TM-T123996

Neobritannilactone B

CAS: 886990-00-7

Formel: C₁₅H₂₀O₃

Reinheit: 95%~99%

Molekulargewicht: 248.3

Ref: BP-BPF2602

Neobritannilactone B

CAS: 886990-00-7

Neobritannilactone B is a sesquiterpene lactone, which is a type of naturally occurring organic compound. It is derived from certain plant species, particularly those within the Asteraceae family. The compound's structural complexity is inherent to its classification, featuring a distinct lactone ring as part of its chemical architecture.

Formel: C₁₅H₂₀O₃

Reinheit: Min. 95%

Molekulargewicht: 248.32 g/mol

Ref: 3D-LKB99000