CAS 928148-51-0

Formel: C32H48O5

InChl: InChI=1S/C32H48O5/c1-18-16-21(27(29(5,6)35)36-19(2)33)37-22-17-32(9)20(26(18)22)10-11-24-30(7)14-13-25(34)28(3,4)23(30)12-15-31(24,32)8/h10-11,18,21-24,27,35H,12-17H2,1-9H3/t18-,21+,22+,23+,24+,27-,30+,31+,32+/m1/s1

InChI Key: YDONEKYGVGENMF-XEDHJYNPSA-N

SMILES: C[C@@H]1C[C@H](O[C@@H]2C1=C3C=C[C@H]4[C@]5(CCC(=O)C([C@@H]5CC[C@@]4([C@]3(C2)C)C)(C)C)C)[C@H](C(C)(C)O)OC(=O)C

Alisol O

CAS: 928148-51-0

Alisol O is a natural product of Alisma, Alismataceae.

Formel: C₃₂H₄₈O₅

Reinheit: 98%

Farbe und Form: Solid

Molekulargewicht: 512.7205

Ref: TM-TN3377

Alisol O

CAS: 928148-51-0

**Alisol O** is a triterpenoid compound, which is derived from the rhizomes of the Alisma plant, specifically Alisma orientale. This plant is a traditional herb known for its diverse range of bioactive compounds. Alisol O, a secondary metabolite, exerts its effects through modulation of various signaling pathways and interactions with cellular receptors, indicating pharmacological relevance.

Formel: C₃₂H₄₈O₅

Reinheit: Min. 95%

Molekulargewicht: 512.70 g/mol

Ref: 3D-DMB14851