CAS 92851-65-5

Formel: C15H15NO4S

InChl: InChI=1S/C15H15NO4S/c1-11-7-9-13(10-8-11)21(19,20)16-14(15(17)18)12-5-3-2-4-6-12/h2-10,14,16H,1H3,(H,17,18)

InChI Key: LIZVXGBYTGTTTI-UHFFFAOYSA-N

SMILES: CC1=CC=C(C=C1)S(=O)(=O)NC(C2=CC=CC=C2)C(=O)O

2-(4-Methylbenzenesulfonamido)-2-phenylacetic acid

CAS: 92851-65-5

2-(4-Methylbenzenesulfonamido)-2-phenylacetic acid is a molecule with two nitrogen atoms in its structure. It contains one carboxylate group and the molecular weight of this compound is 178.22 g/mol. This molecule has a low molecular weight, which makes it a good candidate for use in organic synthesis. It can be produced by reacting ethylene with transition metal ions such as titanium tetrachloride or zirconium tetrachloride. 2-(4-Methylbenzenesulfonamido)-2-phenylacetic acid is resistant to both oxidation and reduction, making it an ideal candidate for use in organic synthesis. 2-(4-Methylbenzenesulfonamido)-2-phenylacetic acid diffracts light at a wavelength of 0.34 nm, making it useful for determining the size and shape of molecules that are crystallized from solution.

Formel: C₁₅H₁₅NO₄S

Reinheit: Min. 95%

Molekulargewicht: 305.4 g/mol

Ref: 3D-SDA85165