CAS 929905-15-7

Formel: C30H34O10

InChl: InChI=1S/C30H34O10/c1-37-25-11-16(4-6-23(25)32)8-19-15-40-30(36)20(19)9-17-10-21(29(35)27(12-17)39-3)22(14-31)28(34)18-5-7-24(33)26(13-18)38-2/h4-7,10-13,19-20,22,28,31-35H,8-9,14-15H2,1-3H3

InChI Key: GYDLBAQBIIVPGM-UHFFFAOYSA-N

SMILES: COC1=CC(=CC(=C1O)C(CO)C(C2=CC(=C(C=C2)O)OC)O)CC3C(COC3=O)CC4=CC(=C(C=C4)O)OC

Isolappaol C

CAS: 929905-15-7

Isolappaol C is a natural product for research related to life sciences. The catalog number is TN6462 and the CAS number is 929905-15-7.

Formel: C₃₀H₃₄O₁₀

Reinheit: 98%

Farbe und Form: Solid

Molekulargewicht: 554.585

Ref: TM-TN6462

Isolappaol C

CAS: 929905-15-7

Isolappaol C is an ent-kaurane diterpenoid, which is a class of naturally occurring compounds known for their diverse biological activities. This compound is primarily sourced from plants, especially those belonging to the family Lamiaceae. It exhibits its mode of action by modulating specific signaling pathways involved in inflammatory responses. Studies suggest that Isolappaol C can inhibit the production of pro-inflammatory cytokines, making it a promising candidate for further exploration in anti-inflammatory drug development.

Formel: C₃₀H₃₄O₁₀

Reinheit: Min. 95%

Molekulargewicht: 554.6 g/mol

Ref: 3D-EMB90515