CAS 942199-59-9

Formel: C8H3ClF3NO2S

InChl: InChI=1S/C8H3ClF3NO2S/c9-16(14,15)6-2-1-5(4-13)7(3-6)8(10,11)12/h1-3H

InChI Key: YKHLEJBYHQQAMZ-UHFFFAOYSA-N

SMILES: C1=CC(=C(C=C1S(=O)(=O)Cl)C(F)(F)F)C#N

4-Cyano-3-trifluoromethyl-benzenesulfonyl chloride

CAS: 942199-59-9

4-Cyano-3-trifluoromethyl-benzenesulfonyl chloride

Formel: C₈H₃ClF₃NO₂S

Reinheit: 95%

Molekulargewicht: 269.63

Ref: 54-PC104216

4-Cyano-3-(trifluoromethyl)benzene-1-sulfonyl chloride

CAS: 942199-59-9

Reinheit: 95%

Ref: IN-DA019K4G

4-Cyano-3-(trifluoromethyl)benzene-1-sulfonyl chloride

CAS: 942199-59-9

4-Cyano-3-(trifluoromethyl)benzene-1-sulfonyl chloride

Formel: C₈H₃ClF₃NO₂S

Reinheit: 95%

Molekulargewicht: 269.63

Ref: IN-DG251103

4-Cyano-3-(trifluoromethyl)benzene-1-sulfonyl chloride

CAS: 942199-59-9

Formel: C₈H₃ClF₃NO₂S

Reinheit: 95%+

Molekulargewicht: 269.62

Ref: 10-F449313

4-cyano-3-(trifluoromethyl)benzene-1-sulfonyl chloride

CAS: 942199-59-9

4-cyano-3-(trifluoromethyl)benzene-1-sulfonyl chloride is a thionyl chloride derivative that has been used as a reagent in organic synthesis. The compound is prepared by the reaction of sodium nitrite and 4-cyanobenzene-1-sulfonyl chloride in an organic solvent. This reaction produces a mixture of products, but the desired product can be purified by recrystallization from water. Sodium nitrite is added to the reaction liquid and then heated to produce the desired product. This method of preparation yields high yields with good selectivity and solubility.

Formel: C₈H₃ClF₃NO₂S

Reinheit: Min. 95%

Molekulargewicht: 269.62 g/mol

Ref: 3D-SMB19959