CAS 942997-00-4

Formel: C53H86O22

InChl: InChI=1S/C53H86O22/c1-23-32(57)36(61)40(65)44(70-23)74-42-33(58)26(56)20-68-46(42)73-31-11-12-49(4)29(50(31,5)22-55)10-13-52(7)30(49)9-8-24-25-18-48(2,3)14-16-53(25,17-15-51(24,52)6)47(67)75-45-41(66)38(63)35(60)28(72-45)21-69-43-39(64)37(62)34(59)27(19-54)71-43/h8,23,25-46,54-66H,9-22H2,1-7H3

InChI Key: GFPLPBCJRRNZHM-UHFFFAOYSA-N

SMILES: CC1C(C(C(C(O1)OC2C(C(COC2OC3CCC4(C(C3(C)CO)CCC5(C4CC=C6C5(CCC7(C6CC(CC7)(C)C)C(=O)OC8C(C(C(C(O8)COC9C(C(C(C(O9)CO)O)O)O)O)O)O)C)C)C)O)O)O)O)O

Dipsacoside B

CAS: 33289-85-9, 942997-00-4

Formel: C₅₃H₈₆O₂₂

Reinheit: 95%~99%

Molekulargewicht: 1075.25

Ref: BP-BP0510

Dipsacoside B

CAS: 942997-00-4

Dipsacoside B is a Chinese herbal extract that has been shown to have potent anticancer properties. It induces apoptosis in cancer cells by inhibiting kinase activity, which is essential for cell growth and division. Dipsacoside B is an analog of capsaicin, a compound found in chili peppers that has been shown to have similar anticancer effects. This herbal extract has been tested on human cancer cell lines and has demonstrated strong inhibition of tumor growth. Dipsacoside B also acts as a protein kinase inhibitor, preventing the activation of kinases that are involved in cancer development and progression. This natural compound can be used as an effective alternative to traditional cancer treatments with fewer side effects. Additionally, dipsacoside B can be detected in urine samples after consumption, making it a promising candidate for further research as a potential cancer therapy.

Formel: C₅₃H₈₆O₂₂

Reinheit: Min. 95%

Molekulargewicht: 1,075.2 g/mol

Ref: 3D-SMB99700