CAS 958885-86-4

Formel: C20H30O3

InChl: InChI=1S/C20H30O3/c1-13-6-7-17-19(2,3)9-5-10-20(17,4)15(13)12-16(21)14-8-11-23-18(14)22/h8,15-17,21H,1,5-7,9-12H2,2-4H3/t15-,16+,17-,20+/m0/s1

InChI Key: NNNUJNWMFLYQTF-PFRQMTDMSA-N

SMILES: C[C@]12CCCC([C@@H]1CCC(=C)[C@@H]2C[C@H](C3=CCOC3=O)O)(C)C

12-Hydroxy-8(17),13-labdadien-16,15-olide

CAS: 958885-86-4

12-Hydroxy-8(17),13-labdadien-16,15-olide is a natural product for research related to life sciences.

Formel: C₂₀H₃₀O₃

Reinheit: 98%

Farbe und Form: Solid

Molekulargewicht: 318.45

Ref: TM-TN2598

12-Hydroxy-8(17),13-labdadien-16,15-olide

CAS: 958885-86-4

Formel: C₂₀H₃₀O₃

Reinheit: 95%~99%

Farbe und Form: Powder

Molekulargewicht: 318.457

Ref: BP-SBP01143

Epivitexolide D

CAS: 958885-86-4

Epivitexolide D is a naturally occurring macrolide compound, which is a secondary metabolite derived from marine organisms such as specific species of marine sponges. This compound demonstrates a fascinating mode of action by interfering with cellular processes critical to the survival and growth of pathogenic organisms. Specifically, Epivitexolide D targets and inhibits specific enzyme pathways, which are essential for the synthesis of vital cell components, thereby disrupting cellular integrity and function.

Formel: C₂₀H₃₀O₃

Reinheit: Min. 95%

Molekulargewicht: 318.4 g/mol

Ref: 3D-INB88586