CAS 959417-17-5

Formel: C15H12O6

InChl: InChI=1S/C15H12O6/c1-6-3-10(17)13(18)14-11(6)8-4-7(20-2)5-9(16)12(8)15(19)21-14/h3-5,16-18H,1-2H3

InChI Key: BVYAURIYXKOUPX-UHFFFAOYSA-N

SMILES: CC1=CC(=C(C2=C1C3=C(C(=CC(=C3)OC)O)C(=O)O2)O)O

4-Hydroxyalternariol 9-methyl ether

CAS: 959417-17-5

4-Hydroxyalternariol 9-methyl ether: antioxidant, antibacterial, MIC 86.7-364.7 uM against various pathogens.

Formel: C₁₅H₁₂O₆

Reinheit: 98%

Farbe und Form: Solid

Molekulargewicht: 288.25

Ref: TM-TN3039

4-Hydroxyalternariol 9-methyl ether

CAS: 959417-17-5

Formel: C₁₅H₁₂O₆

Reinheit: 95%~99%

Molekulargewicht: 288.255

Ref: BP-SBP04400

4-Hydroxyalternariol 9-methyl ether

CAS: 959417-17-5

4-Hydroxyalternariol 9-methyl ether is a mycotoxin derivative, which is produced by certain species of the fungus Alternaria. Its biosynthesis occurs naturally in environments where these fungi proliferate, such as on grains and other food products. The compound is an ether derivative of alternariol, characterized by a hydroxyl group addition, providing unique chemical properties.

Formel: C₁₅H₁₂O₆

Reinheit: Min. 95%

Molekulargewicht: 288.25 g/mol

Ref: 3D-JNB41717