CAS 960594-33-6

Formel: C43H72O5

InChl: InChI=1S/C43H72O5/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-42(45)47-39-41(44)40-48-43(46)38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h5-8,11-14,17-20,41,44H,3-4,9-10,15-16,21-40H2,1-2H3/b7-5-,8-6-,13-11-,14-12-,19-17-,20-18-

InChI Key: WPMYZFCSGMALHM-YTWBPVBXSA-N

SMILES: CC/C=C\C/C=C\C/C=C\CCCCCCCCCC(=O)OCC(O)COC(=O)CCCCCCCCC/C=C\C/C=C\C/C=C\CC

1,3-Dieicosatrienoin

CAS: 960594-33-6

1,3-Dieicosatrienoin is a diacylglycerol that has 11(Z),14(Z),17(Z)-eicosatrienoic acid at the sn-1 and sn-3 positions.

Formel: C₄₃H₇₂O₅

Farbe und Form: Solid

Molekulargewicht: 669.03

Ref: TM-T203690

1,3-Dieicosatrienoin (11Z,14Z, 17Z)

CAS: 960594-33-6

Formel: C43H72O5

Reinheit: >98%

Farbe und Form: Liquid

Molekulargewicht: 669.03

Ref: 48-32-2033

11(Z),14(Z),17(Z)-Dieicosatrienoin

CAS: 960594-33-6

Formel: C43H72O5

Reinheit: >99%

Molekulargewicht: 669.03

Ref: 48-32-2030

1,3-Dieicosatrienoin

CAS: 960594-33-6

1,3-Dieicosatrienoin is a bioactive compound, which is a polyunsaturated fatty acid derivative found in certain natural sources such as marine organisms or plant oils. This compound is characterized by its conjugated triene structure, which differentiates it from other fatty acids. Its mode of action involves interaction with cellular membranes and potential involvement in signaling pathways, influencing various biological processes. This interaction may result in modulation of anti-inflammatory responses and antioxidant activities, although the exact mechanisms can vary depending on the specific system in question. The uses and applications of 1,3-Dieicosatrienoin are currently under investigation, with interest in its potential therapeutic roles in chronic inflammatory conditions and metabolic disorders. Further research is needed to fully elucidate its biological effects and therapeutic potential within different physiological contexts.

Formel: C₄₃H₇₂O₅

Reinheit: Min. 95%

Molekulargewicht: 669 g/mol

Ref: 3D-KNB59433