CAS 97399-90-1

Formel: C16H11NO4

InChl: InChI=1S/C16H11NO4/c1-21-15-12(19)6-9-13-10(17-16(9)20)5-8-7(14(13)15)3-2-4-11(8)18/h2-6,18-19H,1H3,(H,17,20)

InChI Key: WUNSWKSWDUMDTB-UHFFFAOYSA-N

SMILES: COC1=C(C=C2C3=C(C=C4C(=C31)C=CC=C4O)NC2=O)O

Aristolactam AIa

CAS: 97399-90-1

Aristolactam AIa

Molekulargewicht: 281.07

Ref: 10-F563339

Aristolactam AIa

CAS: 97399-90-1

Aristolactam AIa

Formel: C₁₆H₁₁NO₄

Reinheit: 95%

Molekulargewicht: 281.26

Ref: 54-OR1117812

Aristolactam AIa

CAS: 97399-90-1

Formel: C₁₆H₁₁NO₄

Reinheit: 95%

Molekulargewicht: 281.2628

Ref: IN-DA01V4WG

Aristolactam aia

CAS: 97399-90-1

Aristolactam AIA is a type of alkaloid, which is naturally derived from certain plant sources, especially those belonging to the Aristolochia genus. Its mode of action involves the modulation of various biological pathways, potentially including enzyme inhibition and disruption of cellular processes essential for the organism's development and survival. Aristolactam AIA has been studied for its interaction with DNA, indicating possible implications in mutagenicity and carcinogenicity, although specific mechanisms may vary.

Formel: C₁₆H₁₁NO₄

Reinheit: Min. 95%

Molekulargewicht: 281.26 g/mol

Ref: 3D-XDA39990