CAS 97856-19-4

(3S,5R)-5-(1-formylethenyl)-3-hydroxy-2-methylcyclopent-1-en-1-carbaldehyd

Formel: C₁₀H₁₂O₃

InChl: InChI=1/C10H12O3/c1-6(4-11)8-3-10(13)7(2)9(8)5-12/h4-5,8,10,13H,1,3H2,2H3/t8-,10+/m1/s1

(1R-trans)-2-Formyl-4-hydroxy-3-methyl-α-methylene-2-cyclopentene-1-acetaldehyde

CAS: 97856-19-4

Formel: C₁₀H₁₂O₃

Molekulargewicht: 180.2005

Ref: IN-DA005XPH

8,9-Didehydro-7-hydroxydolichodial

CAS: 97856-19-4

8,9-Didehydro-7-hydroxydolichodial is a natural product of Patrinia, Valerianaceae.

Formel: C₁₀H₁₂O₃

Reinheit: 98%

Farbe und Form: Solid

Molekulargewicht: 180.2

Ref: TM-TN3269

8,9-Didehydro-7-hydroxydolichodial

CAS: 97856-19-4

Formel: C₁₀H₁₂O₃

Reinheit: 95%~99%

Molekulargewicht: 180.203

Ref: BP-SBP03345

8,9-Didehydro-7-hydroxydolichodial

CAS: 97856-19-4

8,9-Didehydro-7-hydroxydolichodial is a specialized natural compound known as a sesquiterpene dialdehyde. It is derived from a specific plant source, typically those found in exotic floral species that produce a range of complex secondary metabolites. The compound is characterized by its distinct molecular structure featuring conjugated double bonds and hydroxyl groups.

Formel: C₁₀H₁₂O₃

Reinheit: Min. 95%

Molekulargewicht: 180.2 g/mol

Ref: 3D-XDA85619