CAS 98166-72-4

Formel: C19H12O3

InChl: InChI=1S/C19H12O3/c20-14-8-5-13(6-9-14)18-11-16(21)19-15-4-2-1-3-12(15)7-10-17(19)22-18/h1-11,20H

InChI Key: AUDZFDILQOXUBT-UHFFFAOYSA-N

SMILES: C1=CC=C2C(=C1)C=CC3=C2C(=O)C=C(O3)C4=CC=C(C=C4)O

4'-Hydroxy-β-naphthoflavone

CAS: 98166-72-4

4'-Hydroxy-β-naphthoflavone is a synthetic chemical compound, which is a derivative of flavone. It is primarily sourced through chemical synthesis, allowing for the production of a highly pure and consistent compound for research purposes. The mode of action of 4'-Hydroxy-β-naphthoflavone involves its role as a potent agonist of the aryl hydrocarbon receptor (AhR), a transcription factor involved in the regulation of biological responses to planar aromatic hydrocarbons.

Formel: C₁₉H₁₂O₃

Reinheit: Min. 95%

Molekulargewicht: 288.3 g/mol

Ref: 3D-XH183031