CAS 98570-81-1

Formel: C30H42O10

InChl: InChI=1S/C30H42O10/c1-14-23(32)19(36-4)12-22(38-14)39-17-5-7-27(2)16(10-17)11-20-30(40-20)25(27)24(33)26(34)28(3)18(6-8-29(28,30)35)15-9-21(31)37-13-15/h9,14,16-20,22-25,32-33,35H,5-8,10-13H2,1-4H3/t14-,16-,17-,18+,19-,20-,22-,23-,24-,25+,27-,28-,29+,30-/m0/s1

InChI Key: HGZQTHMHTBGLMG-TZUBOXRBSA-N

SMILES: C[C@H]1[C@@H]([C@H](C[C@@H](O1)O[C@H]2CC[C@]3([C@@H](C2)C[C@H]4[C@@]5([C@@H]3[C@@H](C(=O)[C@]6([C@@]5(CC[C@@H]6C7=CC(=O)OC7)O)C)O)O4)C)OC)O

Cryptanoside A

CAS: 98570-81-1

Cryptanoside A is a natural product from Cryptolepis buchanani.

Formel: C₃₀H₄₂O₁₀

Reinheit: 98%

Farbe und Form: Solid

Molekulargewicht: 562.656

Ref: TM-TN3720

Cryptanoside A

CAS: 98570-81-1

Cryptanoside A is a cycloartane triterpenoid, which is a class of compounds known for their diverse biological activities. It is sourced from the leaves of Cryptomeria japonica, a species commonly known as Japanese cedar. The mode of action of Cryptanoside A involves the modulation of inflammatory pathways. Specifically, it interferes with signaling molecules and enzymes that are pivotal in the inflammatory response, leading to a reduction in the production of pro-inflammatory cytokines. This biochemical modulation makes it a subject of interest for potential therapeutic applications.

Formel: C₃₀H₄₂O₁₀

Reinheit: Min. 95%

Molekulargewicht: 562.6 g/mol

Ref: 3D-YDA57081