CAS 99011-78-6

Formel: C14H17ClN4

InChl: InChI=1S/C14H16N4.ClH/c1-9(2)7-18-8-16-12-13(18)10-5-3-4-6-11(10)17-14(12)15;/h3-6,8-9H,7H2,1-2H3,(H2,15,17);1H

InChI Key: RGKLRAHQVIHCCH-UHFFFAOYSA-N

SMILES: CC(C)CN1C=NC2=C1C3=CC=CC=C3N=C2N.Cl

Imiquimod hydrochloride

CAS: 99011-78-6

Imiquimod hydrochloride

Formel: C₁₄H₁₇ClN₄

Reinheit: 99.5%

Molekulargewicht: 276.77

Ref: 54-BUP15975

Imiquimod hydrochloride

CAS: 99011-78-6

Formel: C₁₄H₁₇ClN₄

Reinheit: 99%

Molekulargewicht: 276.7646

Ref: IN-DA00IK7J

Imiquimod hydrochloride

CAS: 99011-78-6

Imiquimod hydrochloride (R 837 hydrochloride) is a TLR7 agonist and immune response modulator with antiviral and antitumor activity.

Formel: C₁₄H₁₇ClN₄

Reinheit: 99.18% - 99.98%

Farbe und Form: Solid

Molekulargewicht: 276.765

Ref: TM-T22091

Imiquimod hydrochloride

CAS: 99011-78-6

Imiquimod hydrochloride is a topical immune response modifier, which is a synthetic compound with antiviral and antitumor properties. Derived from a class of imidazoquinolines, it functions as an immune system activator. Its mode of action primarily involves the induction of cytokines such as interferon-alpha, interleukins, and tumor necrosis factor through toll-like receptor 7 (TLR7) on immune cells. This stimulation activates both the innate and adaptive immune responses.

Formel: C₁₄H₁₇ClN₄

Reinheit: Min. 95%

Farbe und Form: Powder

Molekulargewicht: 276.76 g/mol

Ref: 3D-ZDA01178

Imiquimod HCl

CAS: 99011-78-6

1-Isobutyl-1H-imidazo[4,5-c]quinolin-4-amine hydrochloride

Formel: C₁₄H₁₇ClN₄

Reinheit: 99%

Molekulargewicht: 276.76

Ref: IN-DG631077