Produktinformation
Name:(S)-HPMPA
Synonyme:
- (S)-9-[3-Hydroxy-2-(phosphonylmethoxy)propyl]adenine
Marke:Biosynth
Beschreibung:(S)-HPMPA is a nucleotide analogue, which is a chemically synthesized compound designed to mimic nucleotides. It acts as both an antiviral and an antitumor agent, sourced primarily through synthetic chemistry involving the modification of naturally occurring nucleotide structures. The mode of action of (S)-HPMPA involves mimicking natural substrates of various viral polymerases and cellular enzymes, thereby inhibiting viral DNA synthesis and disrupting the replication cycle of DNA viruses. Additionally, it can interfere with certain cellular pathways contributing to its antitumor effects.
Hinweis:Unsere Produkte sind nur für Laborzwecke. Für jede andere Verwendung, bitte melden sie sich bei uns.
Chemische Eigenschaften
Molekulargewicht:303.21 g/mol
Formel:C9H14N5O5P
Reinheit:Min. 95%
InChl:InChI=1S/C9H14N5O5P/c10-8-7-9(12-3-11-8)14(4-13-7)1-6(2-15)19-5-20(16,17)18/h3-4,6,15H,1-2,5H2,(H2,10,11,12)(H2,16,17,18)/t6-/m0/s1
InChI Key:InChIKey=FRPXSOOHWNMLPH-LURJTMIESA-N
SMILES:Nc1ncnc2c1ncn2C[C@@H](CO)OCP(=O)(O)O
Technische Anfrage zu: (S)-HPMPA
Bitte verwenden Sie stattdessen den Warenkorb, um ein Angebot oder eine Bestellung anzufordern
Bitte verwenden Sie stattdessen den Warenkorb, um ein Angebot oder eine Bestellung anzufordern. Wenn Sie ein Angebot anfordern oder eine Bestellung aufgeben möchten, legen Sie stattdessen die gewünschten Produkte in Ihren Warenkorb und fordern Sie dann ein Angebot oder eine Bestellung an aus dem Warenkorb. Es ist schneller, billiger und Sie können von den verfügbaren Rabatten und anderen Vorteilen profitieren.