CAS 1000676-45-8

Fórmula: C16H18O3

InChI: InChI=1S/C16H18O3/c1-18-15-10-12(9-14(17)11-15)7-8-13-5-3-4-6-16(13)19-2/h3-6,9-11,17H,7-8H2,1-2H3

Clave InChI: CTQWBUQUEQSOJO-UHFFFAOYSA-N

SMILES: COC1=CC=CC=C1CCC2=CC(=CC(=C2)OC)O

Stilbostemin N

CAS: 1000676-45-8

Stilbostemins N may exhibit moderate antibacterial activities.

Fórmula: C₁₆H₁₈O₃

Pureza: 98%

Forma y color: Solid

Peso molecular: 258.3123

Ref: TM-TN5071

Stilbostemin N

CAS: 1000676-45-8

Stilbostemin N is a synthetic estrogen analogue, which is a compound derived from chemical sources designed to mimic the biological activity of natural estrogens. Its mode of action involves binding to estrogen receptors, leading to enhanced protein synthesis and growth rates in livestock. By influencing hormonal pathways, it promotes an increase in size and feed efficiency.

Fórmula: C₁₆H₁₈O₃

Pureza: Min. 95%

Peso molecular: 258.31 g/mol

Ref: 3D-AQB67645