CAS 1021912-42-4

Fórmula: C26H25ClN2O2

InChI: InChI=1S/C26H25ClN2O2/c1-16-9-17(2)11-19(10-16)23-15-29-25-14-24(27)21(18-5-3-6-20(30)12-18)13-22(25)26(23)31-8-4-7-28/h3,5-6,9-15,30H,4,7-8,28H2,1-2H3

Clave InChI: GXGVWEMSSIKHOZ-UHFFFAOYSA-N

SMILES: CC1=CC(=CC(=C1)C2=C(C3=CC(=C(C=C3N=C2)Cl)C4=CC(=CC=C4)O)OCCCN)C

TC-G 1003

Producto controlado

CAS: 1021912-42-4

Fórmula: C₂₆H₂₅ClN₂O₂

Forma y color: Neat

Peso molecular: 432.942

Ref: TR-T125205

TC-G 1003

CAS: 1021912-42-4

TC-G 1003 is an advanced chemical compound used as an inhibitor in various biochemical research applications. It is derived from highly specialized synthetic processes, ensuring a high degree of purity and specificity in its action. TC-G 1003 functions by selectively inhibiting specific cellular pathways, thus allowing researchers to dissect complex biological mechanisms with precision.

Fórmula: C₂₆H₂₅ClN₂O₂

Pureza: Min. 95%

Peso molecular: 432.9 g/mol

Ref: 3D-WQB91242

TC-G1003

CAS: 1021912-42-4

TC-G1003 is an effective agonist of the somatostatin sst2 receptor.

Fórmula: C₂₆H₂₅ClN₂O₂

Pureza: 98%

Forma y color: Solid

Peso molecular: 432.94

Ref: TM-T24860