CAS 110170-37-1

Fórmula: C14H16O10

InChI: InChI=1S/C14H16O10/c15-6-1-5(2-7(16)10(6)19)12(20)24-11-8(17)3-14(23,13(21)22)4-9(11)18/h1-2,8-9,11,15-19,23H,3-4H2,(H,21,22)/t8-,9-,11?,14?/m1/s1

Clave InChI: OGYBSNRRBNHPNK-LPSXRXAPSA-N

SMILES: C1[C@H](C([C@@H](CC1(C(=O)O)O)O)OC(=O)C2=CC(=C(C(=C2)O)O)O)O

4-Galloylquinic acid

CAS: 110170-37-1

4-Galloylquinic acid shows some antioxidative activity.

Fórmula: C₁₄H₁₆O₁₀

Pureza: 98%

Forma y color: Solid

Peso molecular: 344.27

Ref: TM-TN3030

4-Galloylquinic acid

CAS: 110170-37-1

4-Galloylquinic acid is a polyphenolic compound, which is derived primarily from various plant sources, especially certain fruits and seeds. This compound is synthesized through the esterification of quinic acid and gallic acid. It exhibits its mode of action primarily through its antioxidant properties, which involve scavenging free radicals and chelating metal ions. By interfering with oxidative stress pathways, it plays a significant role in protecting cellular structures from oxidative damage.

Fórmula: C₁₄H₁₆O₁₀

Pureza: Min. 95%

Peso molecular: 344.27 g/mol

Ref: 3D-KEA17037