CAS 1174017-37-8

Fórmula: C30H32O7

InChI: InChI=1S/C30H32O7/c1-14(2)7-9-17-26(33)18(10-8-15(3)4)29-25(27(17)34)28(35)24-23(11-16(5)6)36-22-13-21(32)20(31)12-19(22)30(24)37-29/h7-8,11-13,23,31-34H,9-10H2,1-6H3

Clave InChI: MOPJKKUUKHCZPG-UHFFFAOYSA-N

SMILES: CC(=CCC1=C(C(=C2C(=C1O)C(=O)C3=C(O2)C4=CC(=C(C=C4OC3C=C(C)C)O)O)CC=C(C)C)O)C

Artoheterophyllin B

CAS: 1174017-37-8

Artoheterophyllin B has antiplasmodial activity.

Fórmula: C₃₀H₃₂O₇

Pureza: 98%

Forma y color: Solid

Peso molecular: 504.57

Ref: TM-TN3456

Artoheterophyllin B

CAS: 1174017-37-8

Fórmula: C₃₀H₃₂O₇

Pureza: 95%~99%

Forma y color: Yellow powder

Peso molecular: 504.579

Ref: BP-SBP02037

Artoheterophyllin B

CAS: 1174017-37-8

Artoheterophyllin B is a bioactive compound categorized as a natural product, specifically an alkaloid. It is derived from the plant Artocarpus heterophyllus, commonly known as jackfruit. This compound is isolated from the leaves and other parts of the plant. Artoheterophyllin B exhibits its mode of action primarily through interactions with specific enzymes or cellular receptors, leading to modulation of various biological pathways. Its specific interactions often result in anti-inflammatory, antioxidant, or antimicrobial effects, although the precise mechanisms can vary based on the target organism or pathway.

Fórmula: C₃₀H₃₂O₇

Pureza: Min. 95%

Peso molecular: 504.6 g/mol

Ref: 3D-ZWB01737