CAS 1187932-37-1

Fórmula: C8H11Cl2F3N2

InChI: InChI=1S/C8H9F3N2.2ClH/c9-8(10,11)6-1-2-7(3-4-12)13-5-6;;/h1-2,5H,3-4,12H2;2*1H

Clave InChI: RSBTXAKQCXWAPH-UHFFFAOYSA-N

SMILES: C1=CC(=NC=C1C(F)(F)F)CCN.Cl.Cl

2-[5-(Trifluoromethyl)pyridin-2-yl]ethan-1-amine dihydrochloride

CAS: 1187932-37-1

2-[5-(Trifluoromethyl)pyridin-2-yl]ethan-1-amine dihydrochloride

Peso molecular: 263.08755g/mol

Ref: 54-PC106980

2-(5-Trifluoromethyl-pyridin-2-yl)ethylamine 2HCl

CAS: 1187932-37-1

2-(5-Trifluoromethyl-pyridin-2-yl)ethylamine 2HCl is a fine chemical that can be used as a building block in the synthesis of other compounds. It is also a useful reagent and a speciality chemical, which means it is typically used for research purposes only. This compound has shown to have high quality and versatility, and is often used as an intermediate in the synthesis of complex compounds.

Fórmula: C₈H₉F₃N₂H₂Cl₂

Pureza: Min. 95%

Forma y color: White Powder

Peso molecular: 263.09 g/mol

Ref: 3D-FT162190