CAS 123155-05-5

Fórmula: C56H98O35

InChI: InChI=1S/C56H98O35/c1-64-36-29-22(15-57)78-50(43(36)71-8)86-30-23(16-58)80-52(45(73-10)37(30)65-2)88-32-25(18-60)82-54(47(75-12)39(32)67-4)90-34-27(20-62)84-56(49(77-14)41(34)69-6)91-35-28(21-63)83-55(48(76-13)42(35)70-7)89-33-26(19-61)81-53(46(74-11)40(33)68-5)87-31-24(17-59)79-51(85-29)44(72-9)38(31)66-3/h22-63H,15-21H2,1-14H3/t22-,23-,24-,25-,26-,27-,28-,29-,30-,31-,32-,33-,34-,35-,36-,37-,38?,39+,40+,41-,42+,43-,44-,45-,46-,47-,48-,49-,50-,51-,52-,53-,54-,55-,56-/m1/s1

Clave InChI: RKASCZVTBITFFN-XIINBPJDSA-N

SMILES: CO[C@@H]1[C@H]2[C@H](O[C@@H]([C@@H]1OC)O[C@@H]3[C@H](O[C@@H]([C@@H]([C@H]3OC)OC)O[C@@H]4[C@H](O[C@@H]([C@@H]([C@H]4OC)OC)O[C@@H]5[C@H](O[C@@H]([C@@H](C5OC)OC)O[C@@H]6[C@H](O[C@@H]([C@@H]([C@@H]6OC)OC)O[C@@H]7[C@H](O[C@@H]([C@@H]([C@@H]7OC)OC)O[C@@H]8[C@H](O[C@H](O2)[C@@H]([C@H]8OC)OC)CO)CO)CO)CO)CO)CO)CO

Heptakis(2,3-dimethyl)-β-cyclodextrin

CAS: 123155-05-5

Heptakis(2,3-dimethyl)-β-cyclodextrin is a reagent used in biochemical reactions.

Fórmula: C₅₆H₉₈O₃₅

Peso molecular: 1331.36

Ref: TM-TSH-00089

Heptakis(2,3-dimethyl)-b-cyclodextrin

CAS: 123155-05-5

Ref: 7W-GC4108

Heptakis(2,3-dimethyl)-Beta-cyclodextrin

Producto controlado

CAS: 123155-05-5

Applications β-Cyclodextrin derivative which removed cholesterol from cells, reducing its toxicity.
References Araki, T., et al.: Anal. Sci., 16, 421 (2000), Kiss, T., et al.: Eur. J. Pharm. Sci., 40, 376 (2010),

Fórmula: C₅₆H₉₈O₃₅

Forma y color: Neat

Peso molecular: 1331.36

Ref: TR-H281095

2,3-Dimethyl-β-cyclodextrin

CAS: 123155-05-5

This beta-cyclodextrin (β-CD) derivative is a functionalized cyclic oligosaccharide composed of seven glucose units, characterized by a hydrophilic exterior and a lipophilic cavity (bigger than α-CD and smaller than γ-CDs), which allows it to encapsulate various guest molecules. This structural feature facilitates its use in multiple applications, including pharmaceuticals, food enhancement, and cosmetics. In the pharmaceutical industry, it enhances the solubility and stability of poorly water-soluble drugs, improving their bioavailability and efficacy while also masking unpleasant tastes. The food sector utilizes it as a stabilizer for flavors, colors, and nutrients, extending shelf life by protecting sensitive ingredients from degradation. In cosmetics, it serves as a complexing agent for fragrances and active components, ensuring their stability and controlled release. Its use expands to many other fields, including nanotechnology for drug delivery systems, environmental remediation for extracting organic pollutants, textiles for slow-release fragrances, and analytical chemistry for chiral separation.

Fórmula: C₅₆H₉₈O₃₅

Pureza: Min. 95%

Forma y color: Powder

Peso molecular: 1,331.36 g/mol

Ref: 3D-OH16462