CAS 1258011-97-0

Fórmula: C27H45NO3

InChI: InChI=1S/C27H45NO3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-27(31)28-23(2)21-24-19-20-25(29)26(30)22-24/h10-11,19-20,22-23,29-30H,3-9,12-18,21H2,1-2H3,(H,28,31)/b11-10-

Clave InChI: XIPFMGYXSZQUGV-KHPPLWFESA-N

SMILES: CCCCCCCC/C=C\CCCCCCCC(=O)NC(C)CC1=CC(=C(C=C1)O)O

N-(1-(3,4-Dihydroxyphenyl)propan-2-yl)oleamide

CAS: 1258011-97-0

N-(1-(3,4-Dihydroxyphenyl)propan-2-yl)oleamide: binds CB1 (Ki=365 nM), activates PPARα (EC50=698 nM), reduces rat food intake, no FAAH inhibition.

Fórmula: C₂₇H₄₅NO₃

Forma y color: Solid

Peso molecular: 431.661

Ref: TM-T38223

N-(1-(3,4-Dihydroxyphenyl)propan-2-yl)oleamide

CAS: 1258011-97-0

N-(1-(3,4-Dihydroxyphenyl)propan-2-yl)oleamide is a medicinal compound with potential anticancer properties. It has been shown to induce apoptosis in cancer cells and inhibit tumor growth in cell lines of both Chinese hamster and human origin. This compound acts as an inhibitor of kinase activity, which is essential for cell cycle progression and proliferation. N-(1-(3,4-Dihydroxyphenyl)propan-2-yl)oleamide has also been found in urine and may have potential as a biomarker for cancer diagnosis or treatment monitoring. Its ability to target specific proteins involved in cancer development makes it a promising candidate for future cancer therapies.

Fórmula: C₂₇H₄₅NO₃

Pureza: Min. 95%

Peso molecular: 431.7 g/mol

Ref: 3D-IAC01197