CAS 1424357-72-1

Fórmula: C22H20N4O4

InChI: InChI=1S/C22H20N4O4/c27-20-8-6-15(12-19(20)26(29)30)7-9-21-23-18-14-25(11-10-17(18)22(28)24-21)13-16-4-2-1-3-5-16/h1-9,12,27H,10-11,13-14H2,(H,23,24,28)

Clave InChI: JTYPWCVMZDPROU-UHFFFAOYSA-N

SMILES: C1CN(CC2=C1C(=O)NC(=N2)C=CC3=CC(=C(C=C3)O)[N+](=O)[O-])CC4=CC=CC=C4

7-Benzyl-2-(4-hydroxy-3-nitrostyryl)-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-4(3H)-one

Producto controlado

CAS: 1424357-72-1

Fórmula: C₂₂H₂₀N₄O₄

Forma y color: Neat

Peso molecular: 404.419

Ref: TR-V215200

VS1

CAS: 1424357-72-1

VS1 is a novel synthetic peptide, which is engineered to function as an antimicrobial agent. This peptide originates from recombinant DNA technology, providing a customizable approach to target specific microbial strains. Its mode of action involves the selective disruption of microbial cell membranes, leading to the lysis and consequent death of the target cell. The specificity of VS1 for microbial cells over mammalian cells minimizes off-target effects, making it a highly effective agent for infection control.

Fórmula: C₂₂H₂₀N₄O₄

Pureza: Min. 95%

Peso molecular: 404.42 g/mol

Ref: 3D-BV170074