CAS 14630-08-1

Fórmula: C7H4O2S2

InChI: InChI=1S/C7H4O2S2/c8-7(9)5-1-4-2-10-3-6(4)11-5/h1-3H,(H,8,9)

Clave InChI: IZBPOIZFVYLFEP-UHFFFAOYSA-N

SMILES: C1=C(SC2=CSC=C21)C(=O)O

Thieno[3,4-b]thiopene-2-carboxylic acid

CAS: 14630-08-1

Thieno[3,4-b]thiopene-2-carboxylic acid

Fórmula: C₇H₄O₂S₂

Pureza: 95%

Peso molecular: 184.24

Ref: 54-OR1003574

Thieno[3,4-b]thiophene-2-carboxylic acid

CAS: 14630-08-1

Fórmula: C₇H₄O₂S₂

Pureza: 95%

Forma y color: Solid

Peso molecular: 184.2355

Ref: IN-DA001DVI

Thieno[3,4-b]thiophene-2-carboxylic acid

CAS: 14630-08-1

Thieno[3,4-b]thiophene-2-carboxylic acid is a carboxylic acid. It has the ability to form stable thieno[3,4-b]thiophene-2-carboxylate ions in an aqueous solution. These ions can be detected by spectroscopic studies of the adsorption on electrodes and electrochemical polymerization. Thieno[3,4-b]thiophene-2-carboxylic acid is not easily oxidized or reduced due to its stability and low energy state.

Fórmula: C₈H₆O₂S₂

Pureza: Min. 95%

Peso molecular: 198.26 g/mol

Ref: 3D-PAA63008