CAS 1527467-07-7

Fórmula: C28H44O

InChI: InChI=1S/C28H44O/c1-6-19(2)8-7-9-20(3)24-12-13-25-23-11-10-21-18-22(29)14-16-27(21,4)26(23)15-17-28(24,25)5/h1,10,19-20,22-26,29H,7-9,11-18H2,2-5H3/t19-,20+,22-,23-,24+,25-,26-,27-,28+/m0/s1

Clave InChI: HOUZLWCQDNDNNE-ZRUUVFCLSA-N

SMILES: C[C@H](CCC[C@@H](C)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC=C4[C@@]3(CC[C@@H](C4)O)C)C)C#C

27-Alkyne Cholesterol

CAS: 1527467-07-7

27-Alkyne Cholesterol

Fórmula: C₂₈H₄₄O

Pureza: ≥95%

Peso molecular: 396.66

Ref: 54-OR1152274

27-alkyne Cholesterol

CAS: 1527467-07-7

Fórmula: C28H44O

Pureza: >98%

Forma y color: Solid

Peso molecular: 396.65

Ref: 48-64-0070

27-Alkyne Cholesterol

Producto controlado

CAS: 1527467-07-7

Fórmula: C₂₈H₄₄O

Forma y color: Neat

Peso molecular: 396.648

Ref: TR-A540300

27-alkyne Cholesterol

CAS: 1527467-07-7

27-Alkyne Cholesterol, an alkyne derivative of cholesterol, facilitates the investigation of cholesterol metabolism and localization through click chemistry with reporter azides in both fixed and living cells. It serves as a substrate for enzymes across diverse species such as bacteria, yeast, rat, and human.

Fórmula: C₂₈H₄₄O

Forma y color: Solid

Peso molecular: 396.65

Ref: TM-T85163