CAS 1809085-30-0

Fórmula: C18H15ClFN5O2

InChI: InChI=1S/C18H15ClFN5O2/c1-11-9-24(14-3-2-6-21-17(14)20)18(26)15-7-13(23-25(11)15)10-27-16-5-4-12(19)8-22-16/h2-8,11H,9-10H2,1H3/t11-/m1/s1

Clave InChI: RXRVCJFGSOVYLG-LLVKDONJSA-N

SMILES: C[C@@H]1CN(C(=O)C2=CC(=NN12)COC3=NC=C(C=C3)Cl)C4=C(N=CC=C4)F

VU0650786

CAS: 1809085-30-0

VU0650786

Fórmula: C₁₈H₁₅ClFN₅O₂

Pureza: 99%

Peso molecular: 387.8

Ref: 54-BUP04524

VU0650786

CAS: 1809085-30-0

Ref: IN-DA01V4ID

VU0650786

CAS: 1809085-30-0

VU0650786 is a medicinal compound that has shown promise as an anticancer agent. It is a potent inhibitor of a specific kinase, which plays a crucial role in the cycle of cancer cells. This compound has been shown to induce apoptosis, or programmed cell death, in human cancer cells and tumor models. VU0650786 analogs have also demonstrated strong inhibitory activity against Chinese hamster ovary (CHO) cell protein kinases. The compound has been studied extensively as a potential treatment for various types of cancer, including breast and lung cancer. Its ability to target specific proteins involved in cancer progression makes it an attractive candidate for further research and development of novel cancer therapies.

Fórmula: C₁₈H₁₅ClFN₅O₂

Pureza: Min. 95%

Peso molecular: 387.8 g/mol

Ref: 3D-JXC08530

VU0650786

CAS: 1809085-30-0

VU0650786: selective mGlu3 NAM, CNS-penetrant, IC50 392 nM, shows antidepressant/anxiolytic effects in rodents.

Fórmula: C₁₈H₁₅ClFN₅O₂

Pureza: 99.09%

Forma y color: Solid

Peso molecular: 387.795

Ref: TM-T13318