CAS 182291-65-2

Fórmula: C66H103NO16

InChI: InChI=1S/C66H103NO16/c1-48(29-21-17-13-9-6-5-7-10-14-18-22-30-49(2)66(82)83)65(81)51(4)63(79)39-24-20-16-12-8-11-15-19-23-38-62(78)50(3)64(80)47-61(77)46-60(76)44-56(72)36-27-35-55(71)43-59(75)45-58(74)42-54(70)34-26-32-52(68)31-25-33-53(69)41-57(73)37-28-40-67/h5-12,14-16,18-27,29-31,34,36,39,48,50-63,65,68-79,81H,13,17,28,32-33,35,37-38,40-47,67H2,1-4H3,(H,82,83)/b7-5+,9-6+,12-8+,14-10+,15-11+,20-16+,22-18+,23-19+,29-21+,31-25+,34-26+,36-27+,39-24+,49-30+

Clave InChI: DHFLEVLIHWJIAE-OTPULODUSA-N

SMILES: CC(/C=C/CC/C=C/C=C/C=C/C=C/C=C(\C)/C(=O)O)C(C(C)C(/C=C/C=C/C=C/C=C/C=C/CC(C(C)C(=O)CC(CC(CC(/C=C/CC(CC(CC(CC(/C=C/CC(/C=C/CC(CC(CCCN)O)O)O)O)O)O)O)O)O)O)O)O)O

Linearmycin B

CAS: 182291-65-2

Linearmycin B, a polyene antibiotic from Streptomyces, causes B. subtilis lysis in Streptomyces Mg1 extract.

Fórmula: C₆₆H₁₀₃NO₁₆

Forma y color: Solid

Peso molecular: 1166.541

Ref: TM-T36049

Linearmycin B

CAS: 182291-65-2

Linearmycin B is an analog of tolvaptan that has been shown to have potent anticancer activity. It works as an inhibitor of kinases, which are enzymes that play a crucial role in the growth and survival of cancer cells. Linearmycin B has been found to induce apoptosis in human cancer cell lines, making it a promising candidate for the development of new anticancer drugs. In addition, Linearmycin B has been shown to be effective in inhibiting tumor growth in vivo. This compound may also have potential therapeutic applications beyond cancer treatment, as it has been shown to be a potent inhibitor of urine kinases and Chinese hamster ovary cell protein kinases. Overall, Linearmycin B represents a promising avenue for the development of novel kinase inhibitors with potential therapeutic applications in various diseases.

Fórmula: C₆₆H₁₀₃NO₁₆

Pureza: Min. 95%

Peso molecular: 1,166.5 g/mol

Ref: 3D-HHA29165